methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate

C18H32O4 — CID 4068552

IUPACmethyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate
SMILESCOC(=O)CCCCCCCC1CCC(CC(=O)OC)CC1
InChIInChI=1S/C18H32O4/c1-21-17(19)9-7-5-3-4-6-8-15-10-12-16(13-11-15)14-18(20)22-2/h15-16H,3-14H2,1-2H3
InChIKeySBVXMFWROOMEDZ-UHFFFAOYSA-N
MW312.45 g/mol
LogP4.26
Rot. Bonds10

About methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate

methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate (PubChem CID 4068552) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate.

Molecular Properties

Compound Namemethyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate
PubChem CID4068552
Molecular FormulaC18H32O4
Molecular Weight312.45 g/mol
Exact Mass312.23
IUPAC Namemethyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate
SMILESCOC(=O)CCCCCCCC1CCC(CC(=O)OC)CC1
InChIInChI=1S/C18H32O4/c1-21-17(19)9-7-5-3-4-6-8-15-10-12-16(13-11-15)14-18(20)22-2/h15-16H,3-14H2,1-2H3
InChIKeySBVXMFWROOMEDZ-UHFFFAOYSA-N
XLogP4.26
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.45
LogP ≤ 54.26
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate?
The IUPAC name of methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate (CID 4068552) is methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate.
What is the SMILES notation for methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate?
The canonical SMILES for methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate is COC(=O)CCCCCCCC1CCC(CC(=O)OC)CC1.
What is the InChIKey of methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate?
The InChIKey is SBVXMFWROOMEDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O4/c1-21-17(19)9-7-5-3-4-6-8-15-10-12-16(13-11-15)14-18(20)22-2/h15-16H,3-14H2,1-2H3.
What are the key properties of methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate?
methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate has a molecular weight of 312.45 g/mol, XLogP of 4.26, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-[4-(2-methoxy-2-oxoethyl)cyclohexyl]octanoate is sourced from PubChem (CID 4068552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).