C25H42O5 — CID 56976996
2-[(1S,2S,3S)-3-(oxan-2-yloxy)-2-[1-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]acetaldehyde (PubChem CID 56976996) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is 2-[(1S,2S,3S)-3-(oxan-2-yloxy)-2-[1-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]acetaldehyde.
| Compound Name | 2-[(1S,2S,3S)-3-(oxan-2-yloxy)-2-[1-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 56976996 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 2-[(1S,2S,3S)-3-(oxan-2-yloxy)-2-[1-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]acetaldehyde |
| SMILES | CCCCCCC=C(OC1CCCCO1)[C@H]1[C@H](CC=O)CC[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C25H42O5/c1-2-3-4-5-6-11-21(29-23-12-7-9-18-27-23)25-20(16-17-26)14-15-22(25)30-24-13-8-10-19-28-24/h11,17,20,22-25H,2-10,12-16,18-19H2,1H3/t20-,22-,23?,24?,25+/m0/s1 |
| InChIKey | YQMHJUXITKJBAS-RWAUBKLTSA-N |
| XLogP | 5.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|