C20H30O5 — CID 70586280
methyl 6-hept-1-enyl-4-(oxan-2-yloxy)-2-oxobicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 70586280) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is methyl 6-hept-1-enyl-4-(oxan-2-yloxy)-2-oxobicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | methyl 6-hept-1-enyl-4-(oxan-2-yloxy)-2-oxobicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 70586280 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | methyl 6-hept-1-enyl-4-(oxan-2-yloxy)-2-oxobicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | CCCCCC=CC1C2C(OC3CCCCO3)CC(=O)C12C(=O)OC |
| InChI | InChI=1S/C20H30O5/c1-3-4-5-6-7-10-14-18-15(25-17-11-8-9-12-24-17)13-16(21)20(14,18)19(22)23-2/h7,10,14-15,17-18H,3-6,8-9,11-13H2,1-2H3 |
| InChIKey | RTLSJSVIKQLDIX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|