C26H42O6 — CID 70628190
methyl (Z)-7-[(1R,2S,3R)-2-(8-hydroxyoct-1-enyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoate (PubChem CID 70628190) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S,3R)-2-(8-hydroxyoct-1-enyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S,3R)-2-(8-hydroxyoct-1-enyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70628190 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | methyl (Z)-7-[(1R,2S,3R)-2-(8-hydroxyoct-1-enyl)-3-(oxan-2-yloxy)-5-oxocyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1C(=O)C[C@@H](OC2CCCCO2)[C@H]1C=CCCCCCCO |
| InChI | InChI=1S/C26H42O6/c1-30-25(29)16-10-6-5-8-14-21-22(15-9-4-2-3-7-12-18-27)24(20-23(21)28)32-26-17-11-13-19-31-26/h5,8-9,15,21-22,24,26-27H,2-4,6-7,10-14,16-20H2,1H3/b8-5-,15-9?/t21-,22+,24-,26?/m1/s1 |
| InChIKey | SMTGZOCYVJELPQ-AYIJOYRLSA-N |
| XLogP | 4.89 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|