C30H48F2O7 — CID 90801439
7-[(1R,3R,5S)-2-(4,4-difluoro-3-oxooctylidene)-3,5-bis(oxan-2-yloxy)cyclopentyl]heptanoic acid (PubChem CID 90801439) has the molecular formula C30H48F2O7 and a molecular weight of 558.70 g/mol. Its IUPAC name is 7-[(1R,3R,5S)-2-(4,4-difluoro-3-oxooctylidene)-3,5-bis(oxan-2-yloxy)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,3R,5S)-2-(4,4-difluoro-3-oxooctylidene)-3,5-bis(oxan-2-yloxy)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 90801439 |
| Molecular Formula | C30H48F2O7 |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | 7-[(1R,3R,5S)-2-(4,4-difluoro-3-oxooctylidene)-3,5-bis(oxan-2-yloxy)cyclopentyl]heptanoic acid |
| SMILES | CCCCC(F)(F)C(=O)CC=C1[C@@H](CCCCCCC(=O)O)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C30H48F2O7/c1-2-3-18-30(31,32)26(33)17-16-23-22(12-6-4-5-7-13-27(34)35)24(38-28-14-8-10-19-36-28)21-25(23)39-29-15-9-11-20-37-29/h16,22,24-25,28-29H,2-15,17-21H2,1H3,(H,34,35)/t22-,24+,25-,28?,29?/m1/s1 |
| InChIKey | CZGCSYGWTYMAII-MCZJKALNSA-N |
| XLogP | 6.97 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|