C32H52O8 — CID 56627510
7-[(1R,2R,3R)-2-[(3S,5S)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoic acid (PubChem CID 56627510) has the molecular formula C32H52O8 and a molecular weight of 564.76 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[(3S,5S)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[(3S,5S)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoic acid |
|---|---|
| PubChem CID | 56627510 |
| Molecular Formula | C32H52O8 |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.37 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[(3S,5S)-5-methyl-3-(oxan-2-yloxy)non-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-6-oxoheptanoic acid |
| SMILES | CCCC[C@H](C)C[C@@H](C=C[C@H]1[C@H](OC2CCCCO2)CC(=O)[C@@H]1CC(=O)CCCCC(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C32H52O8/c1-3-4-11-23(2)20-25(39-31-14-7-9-18-37-31)16-17-26-27(21-24(33)12-5-6-13-30(35)36)28(34)22-29(26)40-32-15-8-10-19-38-32/h16-17,23,25-27,29,31-32H,3-15,18-22H2,1-2H3,(H,35,36)/t23-,25+,26+,27+,29+,31?,32?/m0/s1 |
| InChIKey | BCQVUSANXGCMIF-JCOPQPHLSA-N |
| XLogP | 6.39 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|