C22H32O6 — CID 70618138
oxan-2-yl (Z)-7-[(3R)-3-(oxan-2-yloxy)-5-oxocyclopenten-1-yl]hept-5-enoate (PubChem CID 70618138) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is oxan-2-yl (Z)-7-[(3R)-3-(oxan-2-yloxy)-5-oxocyclopenten-1-yl]hept-5-enoate.
| Compound Name | oxan-2-yl (Z)-7-[(3R)-3-(oxan-2-yloxy)-5-oxocyclopenten-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 70618138 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | oxan-2-yl (Z)-7-[(3R)-3-(oxan-2-yloxy)-5-oxocyclopenten-1-yl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\CC1=C[C@H](OC2CCCCO2)CC1=O)OC1CCCCO1 |
| InChI | InChI=1S/C22H32O6/c23-19-16-18(27-21-11-5-7-13-25-21)15-17(19)9-3-1-2-4-10-20(24)28-22-12-6-8-14-26-22/h1,3,15,18,21-22H,2,4-14,16H2/b3-1-/t18-,21?,22?/m0/s1 |
| InChIKey | MPQKELJBVXYZBP-FOWSFOJPSA-N |
| XLogP | 3.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|