C32H47NO3 — CID 10529203
(5Z,8Z,11Z,14Z)-N-[[4-(oxan-2-yloxy)phenyl]methyl]icosa-5,8,11,14-tetraenamide (PubChem CID 10529203) has the molecular formula C32H47NO3 and a molecular weight of 493.73 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-[[4-(oxan-2-yloxy)phenyl]methyl]icosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-[[4-(oxan-2-yloxy)phenyl]methyl]icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 10529203 |
| Molecular Formula | C32H47NO3 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.36 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-[[4-(oxan-2-yloxy)phenyl]methyl]icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCc1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C32H47NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-31(34)33-28-29-23-25-30(26-24-29)36-32-22-19-20-27-35-32/h6-7,9-10,12-13,15-16,23-26,32H,2-5,8,11,14,17-22,27-28H2,1H3,(H,33,34)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | SUPPHFKGAKRGBD-DOFZRALJSA-N |
| XLogP | 8.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|