C14H20O4 — CID 134863248
ethyl (Z)-7-(3-hydroxy-5-oxocyclopenten-1-yl)hept-5-enoate (PubChem CID 134863248) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is ethyl (Z)-7-(3-hydroxy-5-oxocyclopenten-1-yl)hept-5-enoate.
| Compound Name | ethyl (Z)-7-(3-hydroxy-5-oxocyclopenten-1-yl)hept-5-enoate |
|---|---|
| PubChem CID | 134863248 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | ethyl (Z)-7-(3-hydroxy-5-oxocyclopenten-1-yl)hept-5-enoate |
| SMILES | CCOC(=O)CCC/C=C\CC1=CC(O)CC1=O |
| InChI | InChI=1S/C14H20O4/c1-2-18-14(17)8-6-4-3-5-7-11-9-12(15)10-13(11)16/h3,5,9,12,15H,2,4,6-8,10H2,1H3/b5-3- |
| InChIKey | MITQDDAENGLDQH-HYXAFXHYSA-N |
| XLogP | 1.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|