C18H32O4Si2 — CID 70573057
[(Z)-6-[(3R)-5-oxo-3-trimethylsilyloxycyclopenten-1-yl]hex-4-enyl] trimethylsilylformate (PubChem CID 70573057) has the molecular formula C18H32O4Si2 and a molecular weight of 368.62 g/mol. Its IUPAC name is [(Z)-6-[(3R)-5-oxo-3-trimethylsilyloxycyclopenten-1-yl]hex-4-enyl] trimethylsilylformate.
| Compound Name | [(Z)-6-[(3R)-5-oxo-3-trimethylsilyloxycyclopenten-1-yl]hex-4-enyl] trimethylsilylformate |
|---|---|
| PubChem CID | 70573057 |
| Molecular Formula | C18H32O4Si2 |
| Molecular Weight | 368.62 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | [(Z)-6-[(3R)-5-oxo-3-trimethylsilyloxycyclopenten-1-yl]hex-4-enyl] trimethylsilylformate |
| SMILES | C[Si](C)(C)O[C@H]1C=C(C/C=C\CCCOC(=O)[Si](C)(C)C)C(=O)C1 |
| InChI | InChI=1S/C18H32O4Si2/c1-23(2,3)18(20)21-12-10-8-7-9-11-15-13-16(14-17(15)19)22-24(4,5)6/h7,9,13,16H,8,10-12,14H2,1-6H3/b9-7-/t16-/m0/s1 |
| InChIKey | AQZFIGYTUYKFAM-GQSKFBFOSA-N |
| XLogP | 4.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|