C15H22O5 — CID 57011139
4-hydroxy-2-[6-[2-(hydroxymethyl)-1,3-dioxolan-2-yl]hex-2-enyl]cyclopent-2-en-1-one (PubChem CID 57011139) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-hydroxy-2-[6-[2-(hydroxymethyl)-1,3-dioxolan-2-yl]hex-2-enyl]cyclopent-2-en-1-one.
| Compound Name | 4-hydroxy-2-[6-[2-(hydroxymethyl)-1,3-dioxolan-2-yl]hex-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 57011139 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-hydroxy-2-[6-[2-(hydroxymethyl)-1,3-dioxolan-2-yl]hex-2-enyl]cyclopent-2-en-1-one |
| SMILES | O=C1CC(O)C=C1CC=CCCCC1(CO)OCCO1 |
| InChI | InChI=1S/C15H22O5/c16-11-15(19-7-8-20-15)6-4-2-1-3-5-12-9-13(17)10-14(12)18/h1,3,9,13,16-17H,2,4-8,10-11H2 |
| InChIKey | AZCLMBORDMNVAZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|