C19H22N2O5 — CID 57289547
[4-(carbamoylamino)phenyl] 7-(3-hydroxy-5-oxocyclopenten-1-yl)hept-5-enoate (PubChem CID 57289547) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is [4-(carbamoylamino)phenyl] 7-(3-hydroxy-5-oxocyclopenten-1-yl)hept-5-enoate.
| Compound Name | [4-(carbamoylamino)phenyl] 7-(3-hydroxy-5-oxocyclopenten-1-yl)hept-5-enoate |
|---|---|
| PubChem CID | 57289547 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [4-(carbamoylamino)phenyl] 7-(3-hydroxy-5-oxocyclopenten-1-yl)hept-5-enoate |
| SMILES | NC(=O)Nc1ccc(OC(=O)CCCC=CCC2=CC(O)CC2=O)cc1 |
| InChI | InChI=1S/C19H22N2O5/c20-19(25)21-14-7-9-16(10-8-14)26-18(24)6-4-2-1-3-5-13-11-15(22)12-17(13)23/h1,3,7-11,15,22H,2,4-6,12H2,(H3,20,21,25) |
| InChIKey | WOJTUAILJDPKJG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|