C9H11N3O3 — CID 134123032
[4-(carbamoylamino)phenyl] N-methylcarbamate (PubChem CID 134123032) has the molecular formula C9H11N3O3 and a molecular weight of 209.21 g/mol. Its IUPAC name is [4-(carbamoylamino)phenyl] N-methylcarbamate.
| Compound Name | [4-(carbamoylamino)phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 134123032 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | [4-(carbamoylamino)phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C9H11N3O3/c1-11-9(14)15-7-4-2-6(3-5-7)12-8(10)13/h2-5H,1H3,(H,11,14)(H3,10,12,13) |
| InChIKey | ULSVLAGLJDZEMV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |