C10H9Cl2F2NO3 — CID 154400545
[4-(2,2-dichloro-1,1-difluoroethoxy)phenyl] N-methylcarbamate (PubChem CID 154400545) has the molecular formula C10H9Cl2F2NO3 and a molecular weight of 300.09 g/mol. Its IUPAC name is [4-(2,2-dichloro-1,1-difluoroethoxy)phenyl] N-methylcarbamate.
| Compound Name | [4-(2,2-dichloro-1,1-difluoroethoxy)phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 154400545 |
| Molecular Formula | C10H9Cl2F2NO3 |
| Molecular Weight | 300.09 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | [4-(2,2-dichloro-1,1-difluoroethoxy)phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc(OC(F)(F)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C10H9Cl2F2NO3/c1-15-9(16)17-6-2-4-7(5-3-6)18-10(13,14)8(11)12/h2-5,8H,1H3,(H,15,16) |
| InChIKey | CBGDQWBMUGMIOX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.09 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|