C18H15Cl3F2N2O3 — CID 70508140
methyl 2-chloro-N-[[4-(2,2-dichloro-1,1-difluoroethoxy)phenyl]methylcarbamoyl]benzenecarboximidate (PubChem CID 70508140) has the molecular formula C18H15Cl3F2N2O3 and a molecular weight of 451.68 g/mol. Its IUPAC name is methyl 2-chloro-N-[[4-(2,2-dichloro-1,1-difluoroethoxy)phenyl]methylcarbamoyl]benzenecarboximidate.
| Compound Name | methyl 2-chloro-N-[[4-(2,2-dichloro-1,1-difluoroethoxy)phenyl]methylcarbamoyl]benzenecarboximidate |
|---|---|
| PubChem CID | 70508140 |
| Molecular Formula | C18H15Cl3F2N2O3 |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | methyl 2-chloro-N-[[4-(2,2-dichloro-1,1-difluoroethoxy)phenyl]methylcarbamoyl]benzenecarboximidate |
| SMILES | COC(=NC(=O)NCc1ccc(OC(F)(F)C(Cl)Cl)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C18H15Cl3F2N2O3/c1-27-15(13-4-2-3-5-14(13)19)25-17(26)24-10-11-6-8-12(9-7-11)28-18(22,23)16(20)21/h2-9,16H,10H2,1H3,(H,24,26) |
| InChIKey | FAKLLMUHHAHRIN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|