C27H26Cl3F2N3O5 — CID 67205234
2-chloro-N-[[4-(2,2-dichloro-1,1-difluoroethoxy)phenyl]carbamoyl]benzamide;3-(3-methylphenyl)propylcarbamic acid (PubChem CID 67205234) has the molecular formula C27H26Cl3F2N3O5 and a molecular weight of 616.88 g/mol. Its IUPAC name is 2-chloro-N-[[4-(2,2-dichloro-1,1-difluoroethoxy)phenyl]carbamoyl]benzamide;3-(3-methylphenyl)propylcarbamic acid.
| Compound Name | 2-chloro-N-[[4-(2,2-dichloro-1,1-difluoroethoxy)phenyl]carbamoyl]benzamide;3-(3-methylphenyl)propylcarbamic acid |
|---|---|
| PubChem CID | 67205234 |
| Molecular Formula | C27H26Cl3F2N3O5 |
| Molecular Weight | 616.88 g/mol |
| Exact Mass | 615.09 |
| IUPAC Name | 2-chloro-N-[[4-(2,2-dichloro-1,1-difluoroethoxy)phenyl]carbamoyl]benzamide;3-(3-methylphenyl)propylcarbamic acid |
| SMILES | Cc1cccc(CCCNC(=O)O)c1.O=C(NC(=O)c1ccccc1Cl)Nc1ccc(OC(F)(F)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H11Cl3F2N2O3.C11H15NO2/c17-12-4-2-1-3-11(12)13(24)23-15(25)22-9-5-7-10(8-6-9)26-16(20,21)14(18)19;1-9-4-2-5-10(8-9)6-3-7-12-11(13)14/h1-8,14H,(H2,22,23,24,25);2,4-5,8,12H,3,6-7H2,1H3,(H,13,14) |
| InChIKey | VDGANNNUKFIJRK-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.88 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|