C18H9Cl3F8N2O4 — CID 22152458
2-chloro-N-[[3,5-dichloro-4-[1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]phenyl]carbamoyl]benzamide (PubChem CID 22152458) has the molecular formula C18H9Cl3F8N2O4 and a molecular weight of 575.62 g/mol. Its IUPAC name is 2-chloro-N-[[3,5-dichloro-4-[1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]phenyl]carbamoyl]benzamide.
| Compound Name | 2-chloro-N-[[3,5-dichloro-4-[1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 22152458 |
| Molecular Formula | C18H9Cl3F8N2O4 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 573.95 |
| IUPAC Name | 2-chloro-N-[[3,5-dichloro-4-[1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccccc1Cl)Nc1cc(Cl)c(OC(F)(F)C(F)OC(F)(F)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C18H9Cl3F8N2O4/c19-9-4-2-1-3-8(9)13(32)31-15(33)30-7-5-10(20)12(11(21)6-7)34-16(23,24)14(22)35-18(28,29)17(25,26)27/h1-6,14H,(H2,30,31,32,33) |
| InChIKey | YBWCIBYCUOVGNJ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|