C12H7Cl3N2O2S — CID 14600661
2-chloro-N-[(4,5-dichlorothiophen-2-yl)carbamoyl]benzamide (PubChem CID 14600661) has the molecular formula C12H7Cl3N2O2S and a molecular weight of 349.63 g/mol. Its IUPAC name is 2-chloro-N-[(4,5-dichlorothiophen-2-yl)carbamoyl]benzamide.
| Compound Name | 2-chloro-N-[(4,5-dichlorothiophen-2-yl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 14600661 |
| Molecular Formula | C12H7Cl3N2O2S |
| Molecular Weight | 349.63 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | 2-chloro-N-[(4,5-dichlorothiophen-2-yl)carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccccc1Cl)Nc1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C12H7Cl3N2O2S/c13-7-4-2-1-3-6(7)11(18)17-12(19)16-9-5-8(14)10(15)20-9/h1-5H,(H2,16,17,18,19) |
| InChIKey | YENIFTCJRXMPRY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |