C14H10ClF2N3O2 — CID 86041149
N-[(3-amino-2,5-difluorophenyl)carbamoyl]-2-chlorobenzamide (PubChem CID 86041149) has the molecular formula C14H10ClF2N3O2 and a molecular weight of 325.70 g/mol. Its IUPAC name is N-[(3-amino-2,5-difluorophenyl)carbamoyl]-2-chlorobenzamide.
| Compound Name | N-[(3-amino-2,5-difluorophenyl)carbamoyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 86041149 |
| Molecular Formula | C14H10ClF2N3O2 |
| Molecular Weight | 325.70 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-[(3-amino-2,5-difluorophenyl)carbamoyl]-2-chlorobenzamide |
| SMILES | Nc1cc(F)cc(NC(=O)NC(=O)c2ccccc2Cl)c1F |
| InChI | InChI=1S/C14H10ClF2N3O2/c15-9-4-2-1-3-8(9)13(21)20-14(22)19-11-6-7(16)5-10(18)12(11)17/h1-6H,18H2,(H2,19,20,21,22) |
| InChIKey | XUXPYBKEXGVDEJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|