C15H11ClFN3O4 — CID 11544848
2-amino-4-[(2-chloro-4-fluorobenzoyl)carbamoylamino]benzoic acid (PubChem CID 11544848) has the molecular formula C15H11ClFN3O4 and a molecular weight of 351.72 g/mol. Its IUPAC name is 2-amino-4-[(2-chloro-4-fluorobenzoyl)carbamoylamino]benzoic acid.
| Compound Name | 2-amino-4-[(2-chloro-4-fluorobenzoyl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 11544848 |
| Molecular Formula | C15H11ClFN3O4 |
| Molecular Weight | 351.72 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-amino-4-[(2-chloro-4-fluorobenzoyl)carbamoylamino]benzoic acid |
| SMILES | Nc1cc(NC(=O)NC(=O)c2ccc(F)cc2Cl)ccc1C(=O)O |
| InChI | InChI=1S/C15H11ClFN3O4/c16-11-5-7(17)1-3-9(11)13(21)20-15(24)19-8-2-4-10(14(22)23)12(18)6-8/h1-6H,18H2,(H,22,23)(H2,19,20,21,24) |
| InChIKey | SFZAYPRJKCBSPL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.72 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|