C14H10ClFN2O4 — CID 11681381
2-chloro-N-[(3,4-dihydroxyphenyl)carbamoyl]-4-fluorobenzamide (PubChem CID 11681381) has the molecular formula C14H10ClFN2O4 and a molecular weight of 324.70 g/mol. Its IUPAC name is 2-chloro-N-[(3,4-dihydroxyphenyl)carbamoyl]-4-fluorobenzamide.
| Compound Name | 2-chloro-N-[(3,4-dihydroxyphenyl)carbamoyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 11681381 |
| Molecular Formula | C14H10ClFN2O4 |
| Molecular Weight | 324.70 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2-chloro-N-[(3,4-dihydroxyphenyl)carbamoyl]-4-fluorobenzamide |
| SMILES | O=C(NC(=O)c1ccc(F)cc1Cl)Nc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H10ClFN2O4/c15-10-5-7(16)1-3-9(10)13(21)18-14(22)17-8-2-4-11(19)12(20)6-8/h1-6,19-20H,(H2,17,18,21,22) |
| InChIKey | QDEMMBFTFIHBQE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.70 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|