C14H13ClN2O4S2 — CID 167950679
5-[(2-chlorobenzoyl)amino]-3-methyl-N-methylsulfonylthiophene-2-carboxamide (PubChem CID 167950679) has the molecular formula C14H13ClN2O4S2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 5-[(2-chlorobenzoyl)amino]-3-methyl-N-methylsulfonylthiophene-2-carboxamide.
| Compound Name | 5-[(2-chlorobenzoyl)amino]-3-methyl-N-methylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 167950679 |
| Molecular Formula | C14H13ClN2O4S2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 5-[(2-chlorobenzoyl)amino]-3-methyl-N-methylsulfonylthiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccccc2Cl)sc1C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C14H13ClN2O4S2/c1-8-7-11(22-12(8)14(19)17-23(2,20)21)16-13(18)9-5-3-4-6-10(9)15/h3-7H,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | CFOJQRZYKGEADG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |