C21H20ClN3O2S — CID 154774868
2-chloro-N-[4-methyl-5-(2-propan-2-yliminopyridine-1-carbonyl)thiophen-2-yl]benzamide (PubChem CID 154774868) has the molecular formula C21H20ClN3O2S and a molecular weight of 413.93 g/mol. Its IUPAC name is 2-chloro-N-[4-methyl-5-(2-propan-2-yliminopyridine-1-carbonyl)thiophen-2-yl]benzamide.
| Compound Name | 2-chloro-N-[4-methyl-5-(2-propan-2-yliminopyridine-1-carbonyl)thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 154774868 |
| Molecular Formula | C21H20ClN3O2S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-chloro-N-[4-methyl-5-(2-propan-2-yliminopyridine-1-carbonyl)thiophen-2-yl]benzamide |
| SMILES | Cc1cc(NC(=O)c2ccccc2Cl)sc1C(=O)n1cccc/c1=N\C(C)C |
| InChI | InChI=1S/C21H20ClN3O2S/c1-13(2)23-17-10-6-7-11-25(17)21(27)19-14(3)12-18(28-19)24-20(26)15-8-4-5-9-16(15)22/h4-13H,1-3H3,(H,24,26)/b23-17+ |
| InChIKey | YVGIUUGXUCFNLC-HAVVHWLPSA-N |
| XLogP | 4.76 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |