C20H25ClN2O2S — CID 55734516
5-[(2-chlorobenzoyl)amino]-N-heptan-2-yl-3-methylthiophene-2-carboxamide (PubChem CID 55734516) has the molecular formula C20H25ClN2O2S and a molecular weight of 392.95 g/mol. Its IUPAC name is 5-[(2-chlorobenzoyl)amino]-N-heptan-2-yl-3-methylthiophene-2-carboxamide.
| Compound Name | 5-[(2-chlorobenzoyl)amino]-N-heptan-2-yl-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55734516 |
| Molecular Formula | C20H25ClN2O2S |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 5-[(2-chlorobenzoyl)amino]-N-heptan-2-yl-3-methylthiophene-2-carboxamide |
| SMILES | CCCCCC(C)NC(=O)c1sc(NC(=O)c2ccccc2Cl)cc1C |
| InChI | InChI=1S/C20H25ClN2O2S/c1-4-5-6-9-14(3)22-20(25)18-13(2)12-17(26-18)23-19(24)15-10-7-8-11-16(15)21/h7-8,10-12,14H,4-6,9H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | JENUJVQRYBEBLA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|