C22H20ClN3O4S — CID 55734380
2-chloro-N-[5-[[(4-ethoxybenzoyl)amino]carbamoyl]-4-methylthiophen-2-yl]benzamide (PubChem CID 55734380) has the molecular formula C22H20ClN3O4S and a molecular weight of 457.94 g/mol. Its IUPAC name is 2-chloro-N-[5-[[(4-ethoxybenzoyl)amino]carbamoyl]-4-methylthiophen-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-[[(4-ethoxybenzoyl)amino]carbamoyl]-4-methylthiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 55734380 |
| Molecular Formula | C22H20ClN3O4S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-chloro-N-[5-[[(4-ethoxybenzoyl)amino]carbamoyl]-4-methylthiophen-2-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2sc(NC(=O)c3ccccc3Cl)cc2C)cc1 |
| InChI | InChI=1S/C22H20ClN3O4S/c1-3-30-15-10-8-14(9-11-15)20(27)25-26-22(29)19-13(2)12-18(31-19)24-21(28)16-6-4-5-7-17(16)23/h4-12H,3H2,1-2H3,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | QEOIFYJSKRVEKP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|