C25H26ClN3O3S — CID 55734096
2-chloro-N-[4-methyl-5-[4-(2-phenoxyethyl)piperazine-1-carbonyl]thiophen-2-yl]benzamide (PubChem CID 55734096) has the molecular formula C25H26ClN3O3S and a molecular weight of 484.02 g/mol. Its IUPAC name is 2-chloro-N-[4-methyl-5-[4-(2-phenoxyethyl)piperazine-1-carbonyl]thiophen-2-yl]benzamide.
| Compound Name | 2-chloro-N-[4-methyl-5-[4-(2-phenoxyethyl)piperazine-1-carbonyl]thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 55734096 |
| Molecular Formula | C25H26ClN3O3S |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 2-chloro-N-[4-methyl-5-[4-(2-phenoxyethyl)piperazine-1-carbonyl]thiophen-2-yl]benzamide |
| SMILES | Cc1cc(NC(=O)c2ccccc2Cl)sc1C(=O)N1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C25H26ClN3O3S/c1-18-17-22(27-24(30)20-9-5-6-10-21(20)26)33-23(18)25(31)29-13-11-28(12-14-29)15-16-32-19-7-3-2-4-8-19/h2-10,17H,11-16H2,1H3,(H,27,30) |
| InChIKey | TVELFXLKSRRNDO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |