C22H20ClFN2O3S — CID 55789182
5-[(2-chloro-4-fluorobenzoyl)amino]-3-methyl-N-(3-phenoxypropyl)thiophene-2-carboxamide (PubChem CID 55789182) has the molecular formula C22H20ClFN2O3S and a molecular weight of 446.93 g/mol. Its IUPAC name is 5-[(2-chloro-4-fluorobenzoyl)amino]-3-methyl-N-(3-phenoxypropyl)thiophene-2-carboxamide.
| Compound Name | 5-[(2-chloro-4-fluorobenzoyl)amino]-3-methyl-N-(3-phenoxypropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55789182 |
| Molecular Formula | C22H20ClFN2O3S |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 5-[(2-chloro-4-fluorobenzoyl)amino]-3-methyl-N-(3-phenoxypropyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc(F)cc2Cl)sc1C(=O)NCCCOc1ccccc1 |
| InChI | InChI=1S/C22H20ClFN2O3S/c1-14-12-19(26-21(27)17-9-8-15(24)13-18(17)23)30-20(14)22(28)25-10-5-11-29-16-6-3-2-4-7-16/h2-4,6-9,12-13H,5,10-11H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | PWOUVMOXPIXVBF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|