C17H15ClF4N2O3S — CID 78894139
5-[(2-chloro-4-fluorobenzoyl)amino]-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-carboxamide (PubChem CID 78894139) has the molecular formula C17H15ClF4N2O3S and a molecular weight of 438.83 g/mol. Its IUPAC name is 5-[(2-chloro-4-fluorobenzoyl)amino]-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-[(2-chloro-4-fluorobenzoyl)amino]-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78894139 |
| Molecular Formula | C17H15ClF4N2O3S |
| Molecular Weight | 438.83 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 5-[(2-chloro-4-fluorobenzoyl)amino]-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc(F)cc2Cl)sc1C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C17H15ClF4N2O3S/c1-9-6-13(24-15(25)11-3-2-10(19)7-12(11)18)28-14(9)16(26)23-4-5-27-8-17(20,21)22/h2-3,6-7H,4-5,8H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | OQCMBCDIONKKHX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|