C18H14ClFN4O3S — CID 78887621
2-chloro-4-fluoro-N-[4-methyl-5-[(1H-pyrrole-2-carbonylamino)carbamoyl]thiophen-2-yl]benzamide (PubChem CID 78887621) has the molecular formula C18H14ClFN4O3S and a molecular weight of 420.85 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[4-methyl-5-[(1H-pyrrole-2-carbonylamino)carbamoyl]thiophen-2-yl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[4-methyl-5-[(1H-pyrrole-2-carbonylamino)carbamoyl]thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 78887621 |
| Molecular Formula | C18H14ClFN4O3S |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 2-chloro-4-fluoro-N-[4-methyl-5-[(1H-pyrrole-2-carbonylamino)carbamoyl]thiophen-2-yl]benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(F)cc2Cl)sc1C(=O)NNC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C18H14ClFN4O3S/c1-9-7-14(22-16(25)11-5-4-10(20)8-12(11)19)28-15(9)18(27)24-23-17(26)13-3-2-6-21-13/h2-8,21H,1H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | PHTOXTCLZUVRPL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|