C21H17Cl2FN2O3S — CID 55729508
5-[(2-chloro-4-fluorobenzoyl)amino]-N-[2-(4-chlorophenoxy)ethyl]-3-methylthiophene-2-carboxamide (PubChem CID 55729508) has the molecular formula C21H17Cl2FN2O3S and a molecular weight of 467.35 g/mol. Its IUPAC name is 5-[(2-chloro-4-fluorobenzoyl)amino]-N-[2-(4-chlorophenoxy)ethyl]-3-methylthiophene-2-carboxamide.
| Compound Name | 5-[(2-chloro-4-fluorobenzoyl)amino]-N-[2-(4-chlorophenoxy)ethyl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55729508 |
| Molecular Formula | C21H17Cl2FN2O3S |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | 5-[(2-chloro-4-fluorobenzoyl)amino]-N-[2-(4-chlorophenoxy)ethyl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc(F)cc2Cl)sc1C(=O)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17Cl2FN2O3S/c1-12-10-18(26-20(27)16-7-4-14(24)11-17(16)23)30-19(12)21(28)25-8-9-29-15-5-2-13(22)3-6-15/h2-7,10-11H,8-9H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | SKZXPXDHNNRXSJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|