C22H21ClFN3O2S — CID 60508076
5-[(2-chloro-4-fluorobenzoyl)amino]-N-[4-(dimethylamino)-3-methylphenyl]-3-methylthiophene-2-carboxamide (PubChem CID 60508076) has the molecular formula C22H21ClFN3O2S and a molecular weight of 445.95 g/mol. Its IUPAC name is 5-[(2-chloro-4-fluorobenzoyl)amino]-N-[4-(dimethylamino)-3-methylphenyl]-3-methylthiophene-2-carboxamide.
| Compound Name | 5-[(2-chloro-4-fluorobenzoyl)amino]-N-[4-(dimethylamino)-3-methylphenyl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 60508076 |
| Molecular Formula | C22H21ClFN3O2S |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 5-[(2-chloro-4-fluorobenzoyl)amino]-N-[4-(dimethylamino)-3-methylphenyl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2sc(NC(=O)c3ccc(F)cc3Cl)cc2C)ccc1N(C)C |
| InChI | InChI=1S/C22H21ClFN3O2S/c1-12-9-15(6-8-18(12)27(3)4)25-22(29)20-13(2)10-19(30-20)26-21(28)16-7-5-14(24)11-17(16)23/h5-11H,1-4H3,(H,25,29)(H,26,28) |
| InChIKey | DYFCEAWMHFSHMX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|