C22H22ClN3O2S — CID 56586586
N-(3-anilinopropyl)-5-[(2-chlorobenzoyl)amino]-3-methylthiophene-2-carboxamide (PubChem CID 56586586) has the molecular formula C22H22ClN3O2S and a molecular weight of 427.96 g/mol. Its IUPAC name is N-(3-anilinopropyl)-5-[(2-chlorobenzoyl)amino]-3-methylthiophene-2-carboxamide.
| Compound Name | N-(3-anilinopropyl)-5-[(2-chlorobenzoyl)amino]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 56586586 |
| Molecular Formula | C22H22ClN3O2S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N-(3-anilinopropyl)-5-[(2-chlorobenzoyl)amino]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccccc2Cl)sc1C(=O)NCCCNc1ccccc1 |
| InChI | InChI=1S/C22H22ClN3O2S/c1-15-14-19(26-21(27)17-10-5-6-11-18(17)23)29-20(15)22(28)25-13-7-12-24-16-8-3-2-4-9-16/h2-6,8-11,14,24H,7,12-13H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | VXKNKTDBBXWWRI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|