C11H12F3NO5S — CID 91117136
3-[3-(trifluoromethylsulfonyloxy)phenyl]propylcarbamic acid (PubChem CID 91117136) has the molecular formula C11H12F3NO5S and a molecular weight of 327.28 g/mol. Its IUPAC name is 3-[3-(trifluoromethylsulfonyloxy)phenyl]propylcarbamic acid.
| Compound Name | 3-[3-(trifluoromethylsulfonyloxy)phenyl]propylcarbamic acid |
|---|---|
| PubChem CID | 91117136 |
| Molecular Formula | C11H12F3NO5S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 3-[3-(trifluoromethylsulfonyloxy)phenyl]propylcarbamic acid |
| SMILES | O=C(O)NCCCc1cccc(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3NO5S/c12-11(13,14)21(18,19)20-9-5-1-3-8(7-9)4-2-6-15-10(16)17/h1,3,5,7,15H,2,4,6H2,(H,16,17) |
| InChIKey | MMUIPRMJKOLRSW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|