C16H22F3NO6S — CID 59211828
[3-[3-hydroxy-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl] trifluoromethanesulfonate (PubChem CID 59211828) has the molecular formula C16H22F3NO6S and a molecular weight of 413.41 g/mol. Its IUPAC name is [3-[3-hydroxy-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[3-hydroxy-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59211828 |
| Molecular Formula | C16H22F3NO6S |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [3-[3-hydroxy-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(CO)(Cc1cccc(OS(=O)(=O)C(F)(F)F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22F3NO6S/c1-14(2,3)25-13(22)20-15(4,10-21)9-11-6-5-7-12(8-11)26-27(23,24)16(17,18)19/h5-8,21H,9-10H2,1-4H3,(H,20,22) |
| InChIKey | WLMCHGJSQPPOFG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|