C11H14F3NO3S — CID 89209477
[3-(4-aminobutyl)phenyl] trifluoromethanesulfonate (PubChem CID 89209477) has the molecular formula C11H14F3NO3S and a molecular weight of 297.30 g/mol. Its IUPAC name is [3-(4-aminobutyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3-(4-aminobutyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89209477 |
| Molecular Formula | C11H14F3NO3S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | [3-(4-aminobutyl)phenyl] trifluoromethanesulfonate |
| SMILES | NCCCCc1cccc(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3NO3S/c12-11(13,14)19(16,17)18-10-6-3-5-9(8-10)4-1-2-7-15/h3,5-6,8H,1-2,4,7,15H2 |
| InChIKey | AZESXOQVWGVROA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|