C34H32ClF3N4O6 — CID 87316657
2-chloro-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]benzamide;(2E)-2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 87316657) has the molecular formula C34H32ClF3N4O6 and a molecular weight of 685.10 g/mol. Its IUPAC name is 2-chloro-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]benzamide;(2E)-2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | 2-chloro-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]benzamide;(2E)-2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 87316657 |
| Molecular Formula | C34H32ClF3N4O6 |
| Molecular Weight | 685.10 g/mol |
| Exact Mass | 684.20 |
| IUPAC Name | 2-chloro-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]benzamide;(2E)-2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)/C(=N/OC)c1ccccc1COc1cc(C)ccc1C.O=C(NC(=O)c1ccccc1Cl)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H22N2O3.C15H10ClF3N2O3/c1-13-9-10-14(2)17(11-13)24-12-15-7-5-6-8-16(15)18(21-23-4)19(22)20-3;16-12-4-2-1-3-11(12)13(22)21-14(23)20-9-5-7-10(8-6-9)24-15(17,18)19/h5-11H,12H2,1-4H3,(H,20,22);1-8H,(H2,20,21,22,23)/b21-18+; |
| InChIKey | CUNDWWCDGLJEFL-GOSREXKOSA-N |
| XLogP | 7.18 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.10 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|