C15H11ClF3NO3 — CID 18225179
5-chloro-2-hydroxy-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 18225179) has the molecular formula C15H11ClF3NO3 and a molecular weight of 345.70 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 5-chloro-2-hydroxy-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 18225179 |
| Molecular Formula | C15H11ClF3NO3 |
| Molecular Weight | 345.70 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 5-chloro-2-hydroxy-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(OC(F)(F)F)cc1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H11ClF3NO3/c16-10-3-6-13(21)12(7-10)14(22)20-8-9-1-4-11(5-2-9)23-15(17,18)19/h1-7,21H,8H2,(H,20,22) |
| InChIKey | LKFMSSLLFJGBAE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.70 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |