C16H15ClN2O4 — CID 47058003
methyl N-[4-[[(5-chloro-2-hydroxybenzoyl)amino]methyl]phenyl]carbamate (PubChem CID 47058003) has the molecular formula C16H15ClN2O4 and a molecular weight of 334.76 g/mol. Its IUPAC name is methyl N-[4-[[(5-chloro-2-hydroxybenzoyl)amino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[(5-chloro-2-hydroxybenzoyl)amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 47058003 |
| Molecular Formula | C16H15ClN2O4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | methyl N-[4-[[(5-chloro-2-hydroxybenzoyl)amino]methyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(CNC(=O)c2cc(Cl)ccc2O)cc1 |
| InChI | InChI=1S/C16H15ClN2O4/c1-23-16(22)19-12-5-2-10(3-6-12)9-18-15(21)13-8-11(17)4-7-14(13)20/h2-8,20H,9H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | XUKBAHMFAAXMAR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |