C16H12Cl2F3NO2 — CID 30342567
2,5-dichloro-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]benzamide (PubChem CID 30342567) has the molecular formula C16H12Cl2F3NO2 and a molecular weight of 378.18 g/mol. Its IUPAC name is 2,5-dichloro-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]benzamide.
| Compound Name | 2,5-dichloro-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 30342567 |
| Molecular Formula | C16H12Cl2F3NO2 |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 2,5-dichloro-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(OCC(F)(F)F)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H12Cl2F3NO2/c17-11-3-6-14(18)13(7-11)15(23)22-8-10-1-4-12(5-2-10)24-9-16(19,20)21/h1-7H,8-9H2,(H,22,23) |
| InChIKey | CYIOHBGXUKPPLR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |