C15H13F3N2O4 — CID 90342641
3-hydroxy-1-methyl-2-oxo-N-[[4-(trifluoromethoxy)phenyl]methyl]pyridine-4-carboxamide (PubChem CID 90342641) has the molecular formula C15H13F3N2O4 and a molecular weight of 342.27 g/mol. Its IUPAC name is 3-hydroxy-1-methyl-2-oxo-N-[[4-(trifluoromethoxy)phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 3-hydroxy-1-methyl-2-oxo-N-[[4-(trifluoromethoxy)phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 90342641 |
| Molecular Formula | C15H13F3N2O4 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 3-hydroxy-1-methyl-2-oxo-N-[[4-(trifluoromethoxy)phenyl]methyl]pyridine-4-carboxamide |
| SMILES | Cn1ccc(C(=O)NCc2ccc(OC(F)(F)F)cc2)c(O)c1=O |
| InChI | InChI=1S/C15H13F3N2O4/c1-20-7-6-11(12(21)14(20)23)13(22)19-8-9-2-4-10(5-3-9)24-15(16,17)18/h2-7,21H,8H2,1H3,(H,19,22) |
| InChIKey | BCQDBSTXKHACEU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |