About [4-(trifluoromethoxy)phenyl] N-aminocarbamate
[4-(trifluoromethoxy)phenyl] N-aminocarbamate (PubChem CID 143175748) has the molecular formula C8H7F3N2O3
and a molecular weight of 236.15 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl] N-aminocarbamate.
Molecular Properties
| Compound Name | [4-(trifluoromethoxy)phenyl] N-aminocarbamate |
| PubChem CID | 143175748 |
| Molecular Formula | C8H7F3N2O3 |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl] N-aminocarbamate |
| SMILES | NNC(=O)Oc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C8H7F3N2O3/c9-8(10,11)16-6-3-1-5(2-4-6)15-7(14)13-12/h1-4H,12H2,(H,13,14) |
| InChIKey | UVGYFIKRWFMTSN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(trifluoromethoxy)phenyl] N-aminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(trifluoromethoxy)phenyl] N-aminocarbamate?
The IUPAC name of [4-(trifluoromethoxy)phenyl] N-aminocarbamate (CID 143175748) is [4-(trifluoromethoxy)phenyl] N-aminocarbamate.
What is the SMILES notation for [4-(trifluoromethoxy)phenyl] N-aminocarbamate?
The canonical SMILES for [4-(trifluoromethoxy)phenyl] N-aminocarbamate is NNC(=O)Oc1ccc(OC(F)(F)F)cc1.
What is the InChIKey of [4-(trifluoromethoxy)phenyl] N-aminocarbamate?
The InChIKey is UVGYFIKRWFMTSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3N2O3/c9-8(10,11)16-6-3-1-5(2-4-6)15-7(14)13-12/h1-4H,12H2,(H,13,14).
What are the key properties of [4-(trifluoromethoxy)phenyl] N-aminocarbamate?
[4-(trifluoromethoxy)phenyl] N-aminocarbamate has a molecular weight of 236.15 g/mol, XLogP of 1.55, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(trifluoromethoxy)phenyl] N-aminocarbamate is sourced from PubChem (CID 143175748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).