C10H10F3N3O4 — CID 142618625
(E)-3-amino-2-hydrazinyl-3-[4-(trifluoromethoxy)phenoxy]prop-2-enoic acid (PubChem CID 142618625) has the molecular formula C10H10F3N3O4 and a molecular weight of 293.20 g/mol. Its IUPAC name is (E)-3-amino-2-hydrazinyl-3-[4-(trifluoromethoxy)phenoxy]prop-2-enoic acid.
| Compound Name | (E)-3-amino-2-hydrazinyl-3-[4-(trifluoromethoxy)phenoxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 142618625 |
| Molecular Formula | C10H10F3N3O4 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | (E)-3-amino-2-hydrazinyl-3-[4-(trifluoromethoxy)phenoxy]prop-2-enoic acid |
| SMILES | NN/C(C(=O)O)=C(\N)Oc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3N3O4/c11-10(12,13)20-6-3-1-5(2-4-6)19-8(14)7(16-15)9(17)18/h1-4,16H,14-15H2,(H,17,18)/b8-7+ |
| InChIKey | SGFRHAZUZKYNHM-BQYQJAHWSA-N |
| XLogP | 0.64 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|