C16H21ClF3N3O3S — CID 142618583
(E)-3-amino-3-cyclohexylsulfanyl-2-hydrazinylprop-2-enoic acid;1-chloro-4-(trifluoromethoxy)benzene (PubChem CID 142618583) has the molecular formula C16H21ClF3N3O3S and a molecular weight of 427.88 g/mol. Its IUPAC name is (E)-3-amino-3-cyclohexylsulfanyl-2-hydrazinylprop-2-enoic acid;1-chloro-4-(trifluoromethoxy)benzene.
| Compound Name | (E)-3-amino-3-cyclohexylsulfanyl-2-hydrazinylprop-2-enoic acid;1-chloro-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 142618583 |
| Molecular Formula | C16H21ClF3N3O3S |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | (E)-3-amino-3-cyclohexylsulfanyl-2-hydrazinylprop-2-enoic acid;1-chloro-4-(trifluoromethoxy)benzene |
| SMILES | FC(F)(F)Oc1ccc(Cl)cc1.NN/C(C(=O)O)=C(\N)SC1CCCCC1 |
| InChI | InChI=1S/C9H17N3O2S.C7H4ClF3O/c10-8(7(12-11)9(13)14)15-6-4-2-1-3-5-6;8-5-1-3-6(4-2-5)12-7(9,10)11/h6,12H,1-5,10-11H2,(H,13,14);1-4H/b8-7+; |
| InChIKey | HTZGWJBYJCBBGR-USRGLUTNSA-N |
| XLogP | 3.97 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|