C16H13ClF3N3O3S — CID 142617914
(E)-3-amino-3-[4-[3-chloro-4-(trifluoromethoxy)phenyl]phenyl]sulfanyl-2-hydrazinylprop-2-enoic acid (PubChem CID 142617914) has the molecular formula C16H13ClF3N3O3S and a molecular weight of 419.81 g/mol. Its IUPAC name is (E)-3-amino-3-[4-[3-chloro-4-(trifluoromethoxy)phenyl]phenyl]sulfanyl-2-hydrazinylprop-2-enoic acid.
| Compound Name | (E)-3-amino-3-[4-[3-chloro-4-(trifluoromethoxy)phenyl]phenyl]sulfanyl-2-hydrazinylprop-2-enoic acid |
|---|---|
| PubChem CID | 142617914 |
| Molecular Formula | C16H13ClF3N3O3S |
| Molecular Weight | 419.81 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | (E)-3-amino-3-[4-[3-chloro-4-(trifluoromethoxy)phenyl]phenyl]sulfanyl-2-hydrazinylprop-2-enoic acid |
| SMILES | NN/C(C(=O)O)=C(\N)Sc1ccc(-c2ccc(OC(F)(F)F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H13ClF3N3O3S/c17-11-7-9(3-6-12(11)26-16(18,19)20)8-1-4-10(5-2-8)27-14(21)13(23-22)15(24)25/h1-7,23H,21-22H2,(H,24,25)/b14-13+ |
| InChIKey | LNADNECVUJLFLE-BUHFOSPRSA-N |
| XLogP | 3.67 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|