C15H13F3N4O3S — CID 142618533
(E)-3-amino-2-hydrazinyl-3-[4-[5-(trifluoromethoxy)-2-pyridinyl]phenyl]sulfanylprop-2-enoic acid (PubChem CID 142618533) has the molecular formula C15H13F3N4O3S and a molecular weight of 386.36 g/mol. Its IUPAC name is (E)-3-amino-2-hydrazinyl-3-[4-[5-(trifluoromethoxy)-2-pyridinyl]phenyl]sulfanylprop-2-enoic acid.
| Compound Name | (E)-3-amino-2-hydrazinyl-3-[4-[5-(trifluoromethoxy)-2-pyridinyl]phenyl]sulfanylprop-2-enoic acid |
|---|---|
| PubChem CID | 142618533 |
| Molecular Formula | C15H13F3N4O3S |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | (E)-3-amino-2-hydrazinyl-3-[4-[5-(trifluoromethoxy)-2-pyridinyl]phenyl]sulfanylprop-2-enoic acid |
| SMILES | NN/C(C(=O)O)=C(\N)Sc1ccc(-c2ccc(OC(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C15H13F3N4O3S/c16-15(17,18)25-9-3-6-11(21-7-9)8-1-4-10(5-2-8)26-13(19)12(22-20)14(23)24/h1-7,22H,19-20H2,(H,23,24)/b13-12+ |
| InChIKey | KKSNAHURAQDYSQ-OUKQBFOZSA-N |
| XLogP | 2.41 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|