C13H14F3N3O4 — CID 142617773
(E)-3-amino-2-hydrazinyl-3-[[5-(trifluoromethoxy)-2,3-dihydro-1H-inden-2-yl]oxy]prop-2-enoic acid (PubChem CID 142617773) has the molecular formula C13H14F3N3O4 and a molecular weight of 333.27 g/mol. Its IUPAC name is (E)-3-amino-2-hydrazinyl-3-[[5-(trifluoromethoxy)-2,3-dihydro-1H-inden-2-yl]oxy]prop-2-enoic acid.
| Compound Name | (E)-3-amino-2-hydrazinyl-3-[[5-(trifluoromethoxy)-2,3-dihydro-1H-inden-2-yl]oxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 142617773 |
| Molecular Formula | C13H14F3N3O4 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (E)-3-amino-2-hydrazinyl-3-[[5-(trifluoromethoxy)-2,3-dihydro-1H-inden-2-yl]oxy]prop-2-enoic acid |
| SMILES | NN/C(C(=O)O)=C(\N)OC1Cc2ccc(OC(F)(F)F)cc2C1 |
| InChI | InChI=1S/C13H14F3N3O4/c14-13(15,16)23-8-2-1-6-3-9(5-7(6)4-8)22-11(17)10(19-18)12(20)21/h1-2,4,9,19H,3,5,17-18H2,(H,20,21)/b11-10+ |
| InChIKey | QDYRXAJTTZMNEJ-ZHACJKMWSA-N |
| XLogP | 0.74 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|