C16H20F3N3O3S — CID 142618046
(E)-3-amino-2-hydrazinyl-3-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]sulfanylprop-2-enoic acid (PubChem CID 142618046) has the molecular formula C16H20F3N3O3S and a molecular weight of 391.42 g/mol. Its IUPAC name is (E)-3-amino-2-hydrazinyl-3-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]sulfanylprop-2-enoic acid.
| Compound Name | (E)-3-amino-2-hydrazinyl-3-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]sulfanylprop-2-enoic acid |
|---|---|
| PubChem CID | 142618046 |
| Molecular Formula | C16H20F3N3O3S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (E)-3-amino-2-hydrazinyl-3-[4-[4-(trifluoromethoxy)phenyl]cyclohexyl]sulfanylprop-2-enoic acid |
| SMILES | NN/C(C(=O)O)=C(\N)SC1CCC(c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H20F3N3O3S/c17-16(18,19)25-11-5-1-9(2-6-11)10-3-7-12(8-4-10)26-14(20)13(22-21)15(23)24/h1-2,5-6,10,12,22H,3-4,7-8,20-21H2,(H,23,24)/b14-13+ |
| InChIKey | BIIPEUANKWUPPF-BUHFOSPRSA-N |
| XLogP | 3.02 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|