C17H19F3N4O4 — CID 142617885
(E)-3-amino-3-[4-cyano-4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxy-2-hydrazinylprop-2-enoic acid (PubChem CID 142617885) has the molecular formula C17H19F3N4O4 and a molecular weight of 400.36 g/mol. Its IUPAC name is (E)-3-amino-3-[4-cyano-4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxy-2-hydrazinylprop-2-enoic acid.
| Compound Name | (E)-3-amino-3-[4-cyano-4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxy-2-hydrazinylprop-2-enoic acid |
|---|---|
| PubChem CID | 142617885 |
| Molecular Formula | C17H19F3N4O4 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (E)-3-amino-3-[4-cyano-4-[4-(trifluoromethoxy)phenyl]cyclohexyl]oxy-2-hydrazinylprop-2-enoic acid |
| SMILES | N#CC1(c2ccc(OC(F)(F)F)cc2)CCC(O/C(N)=C(/NN)C(=O)O)CC1 |
| InChI | InChI=1S/C17H19F3N4O4/c18-17(19,20)28-12-3-1-10(2-4-12)16(9-21)7-5-11(6-8-16)27-14(22)13(24-23)15(25)26/h1-4,11,24H,5-8,22-23H2,(H,25,26)/b14-13+ |
| InChIKey | ADCAAXITVFZOHC-BUHFOSPRSA-N |
| XLogP | 1.98 |
| TPSA | 143.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|