C9H9F3N4O3 — CID 142618437
(Z)-3-amino-2-hydrazinyl-3-[5-(trifluoromethoxy)-2-pyridinyl]prop-2-enoic acid (PubChem CID 142618437) has the molecular formula C9H9F3N4O3 and a molecular weight of 278.19 g/mol. Its IUPAC name is (Z)-3-amino-2-hydrazinyl-3-[5-(trifluoromethoxy)-2-pyridinyl]prop-2-enoic acid.
| Compound Name | (Z)-3-amino-2-hydrazinyl-3-[5-(trifluoromethoxy)-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 142618437 |
| Molecular Formula | C9H9F3N4O3 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (Z)-3-amino-2-hydrazinyl-3-[5-(trifluoromethoxy)-2-pyridinyl]prop-2-enoic acid |
| SMILES | NN/C(C(=O)O)=C(\N)c1ccc(OC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H9F3N4O3/c10-9(11,12)19-4-1-2-5(15-3-4)6(13)7(16-14)8(17)18/h1-3,16H,13-14H2,(H,17,18)/b7-6- |
| InChIKey | RZAXVIKXKCKCNU-SREVYHEPSA-N |
| XLogP | 0.16 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|