About (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine
(E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine (PubChem CID 142618099) has the molecular formula C20H34N4O4
and a molecular weight of 394.52 g/mol. Its IUPAC name is (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine.
Molecular Properties
| Compound Name | (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine |
| PubChem CID | 142618099 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine |
| SMILES | CN(C)CCCOc1ccccc1.NN/C(C(=O)O)=C(\N)OC1CCCCC1 |
| InChI | InChI=1S/C11H17NO.C9H17N3O3/c1-12(2)9-6-10-13-11-7-4-3-5-8-11;10-8(7(12-11)9(13)14)15-6-4-2-1-3-5-6/h3-5,7-8H,6,9-10H2,1-2H3;6,12H,1-5,10-11H2,(H,13,14)/b;8-7+ |
| InChIKey | ZGNLIISPNNKSOO-ILHSMLOTSA-N |
| XLogP | 2.03 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine?
The IUPAC name of (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine (CID 142618099) is (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine.
What is the SMILES notation for (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine?
The canonical SMILES for (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine is CN(C)CCCOc1ccccc1.NN/C(C(=O)O)=C(\N)OC1CCCCC1.
What is the InChIKey of (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine?
The InChIKey is ZGNLIISPNNKSOO-ILHSMLOTSA-N. The full InChI is InChI=1S/C11H17NO.C9H17N3O3/c1-12(2)9-6-10-13-11-7-4-3-5-8-11;10-8(7(12-11)9(13)14)15-6-4-2-1-3-5-6/h3-5,7-8H,6,9-10H2,1-2H3;6,12H,1-5,10-11H2,(H,13,14)/b;8-7+.
What are the key properties of (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine?
(E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine has a molecular weight of 394.52 g/mol, XLogP of 2.03, 9 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-amino-3-cyclohexyloxy-2-hydrazinylprop-2-enoic acid;N,N-dimethyl-3-phenoxypropan-1-amine is sourced from PubChem (CID 142618099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).